|
CAS#: 91639-76-8 Product: N-[(2-Ethyl-1-Benzofuran-3-Yl)Methyl]-N-Methylamine Hydrochloride No suppilers available for the product. |
| Name | N-[(2-Ethyl-1-Benzofuran-3-Yl)Methyl]-N-Methylamine Hydrochloride |
|---|---|
| Synonyms | (2-Ethylbenzofuran-3-Yl)Methyl-Methyl-Ammonium; (2-Ethyl-3-Benzofuranyl)Methyl-Methylammonium; (2-Ethyl-1-Benzofuran-3-Yl)Methyl-Methyl-Azanium |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16NO |
| Molecular Weight | 190.26 |
| CAS Registry Number | 91639-76-8 |
| SMILES | C2=C1C(=C(OC1=CC=C2)CC)C[NH2+]C |
| InChI | 1S/C12H15NO/c1-3-11-10(8-13-2)9-6-4-5-7-12(9)14-11/h4-7,13H,3,8H2,1-2H3/p+1 |
| InChIKey | WSXGLBZFVZWEQP-UHFFFAOYSA-O |
| Boiling point | 271.162°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 117.795°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(2-Ethyl-1-Benzofuran-3-Yl)Methyl]-N-Methylamine Hydrochloride |