|
CAS#: 916522-63-9 Product: 5-Methyl 1-(2-methyl-2-propanyl) 3-(2-cyano-2-propanyl)-1H-indole-1,5-dicarboxylate No suppilers available for the product. |
| Name | 5-Methyl 1-(2-methyl-2-propanyl) 3-(2-cyano-2-propanyl)-1H-indole-1,5-dicarboxylate |
|---|---|
| Synonyms | 1H-Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 |
| CAS Registry Number | 916522-63-9 |
| SMILES | CC(C)(C)OC(=O)n1cc(c2c1ccc(c2)C(=O)OC)C(C)(C)C#N |
| InChI | 1S/C19H22N2O4/c1-18(2,3)25-17(23)21-10-14(19(4,5)11-20)13-9-12(16(22)24-6)7-8-15(13)21/h7-10H,1-6H3 |
| InChIKey | QDXNSJQXDJKHKO-UHFFFAOYSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.052°C at 760 mmHg (Cal.) |
| Flash point | 244.732°C (Cal.) |
| Refractive index | 1.543 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl 1-(2-methyl-2-propanyl) 3-(2-cyano-2-propanyl)-1H-indole-1,5-dicarboxylate |