|
CAS#: 91719-85-6 Product: 3-(4-Amino-6-Anilino-1,3,5-Triazin-2-Yl)Propanoic Acid No suppilers available for the product. |
| Name | 3-(4-Amino-6-Anilino-1,3,5-Triazin-2-Yl)Propanoic Acid |
|---|---|
| Synonyms | 3-[4-Amino-6-(Phenylamino)-S-Triazin-2-Yl]Propionate; Zinc03888940 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N5O2 |
| Molecular Weight | 258.26 |
| CAS Registry Number | 91719-85-6 |
| SMILES | C2=C(NC1=NC(=NC(=N1)N)CCC([O-])=O)C=CC=C2 |
| InChI | 1S/C12H13N5O2/c13-11-15-9(6-7-10(18)19)16-12(17-11)14-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,18,19)(H3,13,14,15,16,17)/p-1 |
| InChIKey | YHFYRDPSKOMPRH-UHFFFAOYSA-M |
| Boiling point | 585.024°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 307.612°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Amino-6-Anilino-1,3,5-Triazin-2-Yl)Propanoic Acid |