|
CAS#: 918513-18-5 Product: 4-Piperidinyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone No suppilers available for the product. |
| Name | 4-Piperidinyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| Synonyms | Methanone, 4-piperidinyl-1H-pyrrolo[2,3-b]pyridin-3-yl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 |
| CAS Registry Number | 918513-18-5 |
| SMILES | c1cc2c(c[nH]c2nc1)C(=O)C3CCNCC3 |
| InChI | 1S/C13H15N3O/c17-12(9-3-6-14-7-4-9)11-8-16-13-10(11)2-1-5-15-13/h1-2,5,8-9,14H,3-4,6-7H2,(H,15,16) |
| InChIKey | GIYPQWAGUBIWBL-UHFFFAOYSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.03°C at 760 mmHg (Cal.) |
| Flash point | 224.761°C (Cal.) |
| Refractive index | 1.636 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Piperidinyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |