Online Database of Chemicals from Around the World
| Eburon Organics bvba | Belgium | Inquire | ||
|---|---|---|---|---|
 |
+32 (51) 335-068 | |||
 |
sales@eburon-organics.com | |||
| Chemical manufacturer | ||||
| Name | Homocitric Acid-gamma-Lactone |
|---|---|
| Synonyms | Carboxy 2-(5-Oxotetrahydrofuran-2-Yl)Acetate; 2-(5-Oxo-2-Tetrahydrofuranyl)Acetic Acid Carboxy Ester; 2-(5-Ketotetrahydrofuran-2-Yl)Acetic Acid Carboxy Ester |
| Molecular Structure |  |
| Molecular Formula | C7H8O6 |
| Molecular Weight | 188.14 |
| CAS Registry Number | 91912-46-8 |
| SMILES | C(C1OC(CC1)=O)C(=O)OC(=O)O |
| InChI | 1S/C7H8O6/c8-5-2-1-4(12-5)3-6(9)13-7(10)11/h4H,1-3H2,(H,10,11) |
| InChIKey | ZLAAIVBHMNPPEF-UHFFFAOYSA-N |
| Density | 1.465g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.062°C at 760 mmHg (Cal.) |
| Flash point | 183.761°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Homocitric Acid-gamma-Lactone |