Online Database of Chemicals from Around the World
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (571) 8708-6220 | |||
 |
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | 6-chloro-N-[(3,4-dimethylphenyl)methyl]pyridazin-3-amine |
|---|---|
| Synonyms | 3-Pyridazinamine, 6-chloro-N-[(3,4-dimethylphenyl)methyl]- |
| Molecular Structure | ![CAS#: 919522-42-2， 6-chloro-N-[(3,4-dimethylphenyl)methyl]pyridazin-3-amine](/moreStructures/919522-42-2.gif) |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.72 |
| CAS Registry Number | 919522-42-2 |
| SMILES | Cc1ccc(cc1C)CNc2ccc(nn2)Cl |
| InChI | 1S/C13H14ClN3/c1-9-3-4-11(7-10(9)2)8-15-13-6-5-12(14)16-17-13/h3-7H,8H2,1-2H3,(H,15,17) |
| InChIKey | WDDJJWCNHSCRPL-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.229°C at 760 mmHg (Cal.) |
| Flash point | 230.929°C (Cal.) |
| Refractive index | 1.626 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-chloro-N-[(3,4-dimethylphenyl)methyl]pyridazin-3-amine |