Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 8-Amino-7-methylphenazin-2-ol |
|---|---|
| Synonyms | Nsc408737; 2-Phenazinol, 8-Amino-7-Methyl-; 5-25-13-00234 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 |
| CAS Registry Number | 92-25-1 |
| EINECS | 202-139-4 |
| SMILES | C1=C(N)C(=CC3=C1NC2=CC(=O)C=CC2=N3)C |
| InChI | 1S/C13H11N3O/c1-7-4-11-13(6-9(7)14)16-12-5-8(17)2-3-10(12)15-11/h2-6,16H,14H2,1H3 |
| InChIKey | LGQZMAGQTFELEU-UHFFFAOYSA-N |
| Density | 1.417g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.804°C at 760 mmHg (Cal.) |
| Flash point | 219.786°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Amino-7-methylphenazin-2-ol |