Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 6-Chloro-8-Ethyl-9H-Purine |
|---|---|
| Synonyms | Nsc25735 |
| Molecular Structure |  |
| Molecular Formula | C7H7ClN4 |
| Molecular Weight | 182.61 |
| CAS Registry Number | 92001-53-1 |
| SMILES | C1=NC(=C2C(=N1)N=C([NH]2)CC)Cl |
| InChI | 1S/C7H7ClN4/c1-2-4-11-5-6(8)9-3-10-7(5)12-4/h3H,2H2,1H3,(H,9,10,11,12) |
| InChIKey | PNSVJHYYAASBNE-UHFFFAOYSA-N |
| Density | 1.446g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.204°C at 760 mmHg (Cal.) |
| Flash point | 233.103°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-8-Ethyl-9H-Purine |