Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Ethyl 2-(4-methylphenyl)-1,3-oxazole-4-carboxylate |
|---|---|
| Synonyms | 2-p-Tolyl-oxazole-4-carboxylicacidethylester |
| Molecular Structure |  |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 |
| CAS Registry Number | 92029-41-9 |
| SMILES | O=C(OCC)c1nc(oc1)c2ccc(cc2)C |
| InChI | 1S/C13H13NO3/c1-3-16-13(15)11-8-17-12(14-11)10-6-4-9(2)5-7-10/h4-8H,3H2,1-2H3 |
| InChIKey | NQPSUHIEFYILTI-UHFFFAOYSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.468°C at 760 mmHg (Cal.) |
| Flash point | 166.362°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-(4-methylphenyl)-1,3-oxazole-4-carboxylate |