Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,2-Dimethylcyclobutyl phenylcarbamate |
|---|---|
| Synonyms | 1,2-dimethylcyclobutyl phenylcarbamate |
| Molecular Structure |  |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 |
| CAS Registry Number | 92040-82-9 |
| SMILES | CC1CCC1(C)OC(=O)Nc2ccccc2 |
| InChI | 1S/C13H17NO2/c1-10-8-9-13(10,2)16-12(15)14-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,14,15) |
| InChIKey | PRSCNHUJSVRBRG-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.543°C at 760 mmHg (Cal.) |
| Flash point | 119.235°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dimethylcyclobutyl phenylcarbamate |