Online Database of Chemicals from Around the World
|
CAS#: 92078-74-5 Product: 1-Oxiranylpyrene No suppilers available for the product. |
| Name | 1-Oxiranylpyrene |
|---|---|
| Synonyms | 2-(1-Pyrenyl)Oxirane; 1-Pyrenyloxirane; Nsc289903 |
| Molecular Structure |  |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 |
| CAS Registry Number | 92078-74-5 (61695-74-7) |
| SMILES | C1=C5C2=C(C=C1)C=CC3=C2C(=CC=C3C4OC4)C=C5 |
| InChI | 1S/C18H12O/c1-2-11-4-5-13-6-8-14(16-10-19-16)15-9-7-12(3-1)17(11)18(13)15/h1-9,16H,10H2 |
| InChIKey | SWMBSMJCJWZRNR-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.437°C at 760 mmHg (Cal.) |
| Flash point | 215.077°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Oxiranylpyrene |