|
CAS#: 92151-76-3 Product: 9H-Fluorene-3-Carboxylic Acid No suppilers available for the product. |
| Name | 9H-Fluorene-3-Carboxylic Acid |
|---|---|
| Synonyms | Zinc04219067 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9O2 |
| Molecular Weight | 209.22 |
| CAS Registry Number | 92151-76-3 |
| SMILES | C1=C(C=CC3=C1C2=CC=CC=C2C3)C([O-])=O |
| InChI | 1S/C14H10O2/c15-14(16)11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-6,8H,7H2,(H,15,16)/p-1 |
| InChIKey | WYRSPZVTTMUNBL-UHFFFAOYSA-M |
| Boiling point | 408.923°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 183.869°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9H-Fluorene-3-Carboxylic Acid |