|
CAS#: 922501-02-8 Product: {4-[4-(Dimethylamino)butyl]phenyl}boronic acid No suppilers available for the product. |
| Name | {4-[4-(Dimethylamino)butyl]phenyl}boronic acid |
|---|---|
| Synonyms | {4-[4-(Dimethylamino)butyl]phenyl}boronic acid; {4-[4-(Dimethylamino)butyl]phenyl}borsäure; 4-(4-(dimethylamino)butyl)phenylboronic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20BNO2 |
| Molecular Weight | 221.10 |
| CAS Registry Number | 922501-02-8 |
| SMILES | B(c1ccc(cc1)CCCCN(C)C)(O)O |
| InChI | 1S/C12H20BNO2/c1-14(2)10-4-3-5-11-6-8-12(9-7-11)13(15)16/h6-9,15-16H,3-5,10H2,1-2H3 |
| InChIKey | SDZAJVZZRHRXAF-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.8±52.0°C at 760 mmHg (Cal.) |
| Flash point | 179.2±30.7°C (Cal.) |
| Refractive index | 1.525 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for {4-[4-(Dimethylamino)butyl]phenyl}boronic acid |