Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2,3,4,8,9-Hexachlorodibenzofuran |
|---|---|
| Synonyms | Hexachlorodibenzofuran; Dibenzofuran, 1,2,3,4,8,9-Hexachloro-; Dibenzofuran, 1,2,3,4,8,9-Hexachloro |
| Molecular Structure |  |
| Molecular Formula | C12H2Cl6O |
| Molecular Weight | 374.87 |
| CAS Registry Number | 92341-07-6 |
| SMILES | C3=C(C(=C2C1=C(C(=C(C(=C1OC2=C3)Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H2Cl6O/c13-3-1-2-4-5(7(3)14)6-8(15)9(16)10(17)11(18)12(6)19-4/h1-2H |
| InChIKey | VSDUQUBUJRNREH-UHFFFAOYSA-N |
| Density | 1.767g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.464°C at 760 mmHg (Cal.) |
| Flash point | 241.352°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,8,9-Hexachlorodibenzofuran |