Online Database of Chemicals from Around the World
|
CAS#: 92440-49-8 Product: 5-(P-Aminobenzamido)-4-(2-Methoxyethyl)-3-Methylisoxazole No suppilers available for the product. |
| Name | 5-(P-Aminobenzamido)-4-(2-Methoxyethyl)-3-Methylisoxazole |
|---|---|
| Synonyms | 4-Amino-N-[4-(2-Methoxyethyl)-3-Methyl-Isoxazol-5-Yl]Benzamide; 4-Amino-N-[4-(2-Methoxyethyl)-3-Methyl-5-Isoxazolyl]Benzamide; 5-(P-Aminobenzamido)-4-(2-Methoxyethyl)-3-Methylisoxazole |
| Molecular Structure |  |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 |
| CAS Registry Number | 92440-49-8 |
| SMILES | C2=C(C(=O)NC1=C(C(=NO1)C)CCOC)C=CC(=C2)N |
| InChI | 1S/C14H17N3O3/c1-9-12(7-8-19-2)14(20-17-9)16-13(18)10-3-5-11(15)6-4-10/h3-6H,7-8,15H2,1-2H3,(H,16,18) |
| InChIKey | UDVNSZOBOZPUTL-UHFFFAOYSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.476°C at 760 mmHg (Cal.) |
| Flash point | 190.558°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(P-Aminobenzamido)-4-(2-Methoxyethyl)-3-Methylisoxazole |