Online Database of Chemicals from Around the World
|
CAS#: 925-05-3 Product: Isobutyl hydrogen maleate No suppilers available for the product. |
| Name | Isobutyl hydrogen maleate |
|---|---|
| Synonyms | (Z)-4-Isobutoxy-4-Oxo-But-2-Enoic Acid; (Z)-4-Isobutoxy-4-Oxobut-2-Enoic Acid; (Z)-4-Isobutoxy-4-Keto-But-2-Enoic Acid |
| Molecular Structure |  |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 |
| CAS Registry Number | 925-05-3 |
| EINECS | 213-112-1 |
| SMILES | C(OC(=O)\C=C/C(=O)O)C(C)C |
| InChI | 1S/C8H12O4/c1-6(2)5-12-8(11)4-3-7(9)10/h3-4,6H,5H2,1-2H3,(H,9,10)/b4-3- |
| InChIKey | UKXDHEBARGMWMO-ARJAWSKDSA-N |
| Density | 1.128g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.383°C at 760 mmHg (Cal.) |
| Flash point | 110.051°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isobutyl hydrogen maleate |