|
CAS#: 925672-87-3 Product: Methyl (5-bromo-2-cyanophenyl)(cyano)acetate No suppilers available for the product. |
| Name | Methyl (5-bromo-2-cyanophenyl)(cyano)acetate |
|---|---|
| Synonyms | 5-Bromo-a,2-dicyanobenzeneacetic acid methyl ester |
| Molecular Formula | C11H7BrN2O2 |
| Molecular Weight | 279.09 |
| CAS Registry Number | 925672-87-3 |
| SMILES | COC(=O)C(C#N)C1=C(C=CC(=C1)Br)C#N |
| InChI | 1S/C11H7BrN2O2/c1-16-11(15)10(6-14)9-4-8(12)3-2-7(9)5-13/h2-4,10H,1H3 |
| InChIKey | DLORCFNKNRMRFO-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.3±45.0°C at 760 mmHg (Cal.) |
| Flash point | 207.4±28.7°C (Cal.) |
| Refractive index | 1.588 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (5-bromo-2-cyanophenyl)(cyano)acetate |