Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Merck Millipore | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (10) 5989-8600 | |||
|
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Name | N-Formyl-3-methyl-D-valine |
|---|---|
| Synonyms | (+)-N-FORMYL-D-TERT-LEUCINE; D-Valine, N-formyl-3-methyl-; N-Formyl-3-methyl-D-valin |
| Molecular Structure |  |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 |
| CAS Registry Number | 92571-59-0 |
| SMILES | CC(C)(C)[C@H](C(=O)O)NC=O |
| InChI | 1S/C7H13NO3/c1-7(2,3)5(6(10)11)8-4-9/h4-5H,1-3H3,(H,8,9)(H,10,11)/t5-/m0/s1 |
| InChIKey | WVCGTXBZDLZEDU-YFKPBYRVSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 219-221°C (Expl.) |
| Boiling point | 351.2±25.0°C at 760 mmHg (Cal.) |
| Flash point | 166.2±23.2°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Formyl-3-methyl-D-valine |