Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Methyl-3-propylfuro[3,4-b][1,4]benzodioxine |
|---|---|
| Synonyms | 1-methyl-3-propylbenzo[b]furo[3,4-e][1,4]dioxine |
| Molecular Structure | ![CAS#: 926276-88-2， 1-Methyl-3-propylfuro[3,4-b][1,4]benzodioxine](/moreStructures/926276-88-2.gif) |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 |
| CAS Registry Number | 926276-88-2 |
| SMILES | O1c3c(Oc2c1c(oc2CCC)C)cccc3 |
| InChI | 1S/C14H14O3/c1-3-6-12-14-13(9(2)15-12)16-10-7-4-5-8-11(10)17-14/h4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | NZJUYDWQOILSJS-UHFFFAOYSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.111°C at 760 mmHg (Cal.) |
| Flash point | 165.226°C (Cal.) |
| Refractive index | 1.561 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-propylfuro[3,4-b][1,4]benzodioxine |