Online Database of Chemicals from Around the World
|
CAS#: 92631-69-1 Product: Kumujancine No suppilers available for the product. |
| Name | Kumujancine |
|---|---|
| Synonyms | 4-Methoxy-9H-Pyrido[3,4-B]Indole-1-Carboxaldehyde; 4-Methoxy-9H-$B-Carboline-1-Carbaldehyde; Kumujancine |
| Molecular Structure |  |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 92631-69-1 |
| SMILES | C1=CC=CC3=C1C2=C(C=NC(=C2[NH]3)C=O)OC |
| InChI | 1S/C13H10N2O2/c1-17-11-6-14-10(7-16)13-12(11)8-4-2-3-5-9(8)15-13/h2-7,15H,1H3 |
| InChIKey | NHVDRRXZBKLFSV-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.029°C at 760 mmHg (Cal.) |
| Flash point | 248.346°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Kumujancine |