Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3-[2-(2-Piperidinyl)ethyl]-1H-indole |
|---|---|
| Synonyms | 1H-Indole, 3-[2-(2-piperidinyl)ethyl]-; 3-(2-(PIPERIDIN-2-YL)ETHYL)-1H-INDOLE; 3-[2-(2-Piperidinyl)ethyl]-1H-indol |
| Molecular Structure | ![CAS#: 92647-73-9， 3-[2-(2-Piperidinyl)ethyl]-1H-indole](/moreStructures/92647-73-9.gif) |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.33 |
| CAS Registry Number | 92647-73-9 |
| SMILES | c1ccc2c(c1)c(c[nH]2)CCC3CCCCN3 |
| InChI | 1S/C15H20N2/c1-2-7-15-14(6-1)12(11-17-15)8-9-13-5-3-4-10-16-13/h1-2,6-7,11,13,16-17H,3-5,8-10H2 |
| InChIKey | INESWDCREILNOK-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.1±18.0°C at 760 mmHg (Cal.) |
| Flash point | 198.8±21.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[2-(2-Piperidinyl)ethyl]-1H-indole |