|
CAS#: 92654-79-0 Product: 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenecarbaldehyde No suppilers available for the product. |
| Name | 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenecarbaldehyde |
|---|---|
| Synonyms | 5,5,8,8-t |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 |
| CAS Registry Number | 92654-79-0 |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)C=O)(C)C)C |
| InChI | 1S/C15H20O/c1-14(2)7-8-15(3,4)13-9-11(10-16)5-6-12(13)14/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | RRAGXXOTEICTAF-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.6±31.0°C at 760 mmHg (Cal.) |
| Flash point | 118.9±11.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenecarbaldehyde |