Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N4-Methyl-N4-Phenyl-2,4,6-Pyrimidinetriamine |
|---|---|
| Synonyms | N4-Methyl-N4-Phenyl-Pyrimidine-2,4,6-Triamine; (2,6-Diaminopyrimidin-4-Yl)-Methyl-Phenyl-Amine; Nsc48257 |
| Molecular Structure |  |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 |
| CAS Registry Number | 92722-34-4 |
| SMILES | C1=CC=CC=C1N(C)C2=CC(=NC(=N2)N)N |
| InChI | 1S/C11H13N5/c1-16(8-5-3-2-4-6-8)10-7-9(12)14-11(13)15-10/h2-7H,1H3,(H4,12,13,14,15) |
| InChIKey | ADSJGZZCGGWLFY-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.486°C at 760 mmHg (Cal.) |
| Flash point | 262.533°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N4-Methyl-N4-Phenyl-2,4,6-Pyrimidinetriamine |