|
CAS#: 92836-10-7 Product: 1-(1-Isopropyl-1,3,3,6-tetramethyl-2,3-dihydro-1H-inden-5-yl)ethanone No suppilers available for the product. |
| Name | 1-(1-Isopropyl-1,3,3,6-tetramethyl-2,3-dihydro-1H-inden-5-yl)ethanone |
|---|---|
| Synonyms | Acylindane; EE4111809; Methyl-(1,3,3,6-tetramethyl-1-isopropylindaan-5-yl)keton |
| Molecular Structure | ![]() |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 |
| CAS Registry Number | 92836-10-7 |
| SMILES | O=C(c1cc2c(cc1C)C(CC2(C)C)(C)C(C)C)C |
| InChI | 1S/C18H26O/c1-11(2)18(7)10-17(5,6)15-9-14(13(4)19)12(3)8-16(15)18/h8-9,11H,10H2,1-7H3 |
| InChIKey | HADLISHZBKJUMM-UHFFFAOYSA-N |
| Density | 0.939g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.406°C at 760 mmHg (Cal.) |
| Flash point | 148.137°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Isopropyl-1,3,3,6-tetramethyl-2,3-dihydro-1H-inden-5-yl)ethanone |