Online Database of Chemicals from Around the World

1,3-dichloro-2-fluoro-5-[1-(trifluoromethyl)ethenyl]-Benzene
[CAS 928783-84-0]

List of Suppliers
Beijing Eagle Sky Pharmatech Co., Ltd. China
www.eagleskypharmatech.com
+86 (10) 5979-9429
8875-5821
+86 (10) 5804-3698
sophia_818@126.com
contact@eagleskypharmatech.com
QQ Chat
Chemical manufacturer since 2009
chemBlink Standard supplier since 2010

Identification
ClassificationOrganic raw materials >> Organic fluorine compound
Name1,3-dichloro-2-fluoro-5-[1-(trifluoromethyl)ethenyl]-Benzene
Molecular Structure1,3-dichloro-2-fluoro-5-[1-(trifluoromethyl)ethenyl]-Benzene molecular structure (CAS 928783-84-0)
Molecular FormulaC9H4Cl2F4
Molecular Weight259.03
CAS Registry Number928783-84-0
SMILESC=C(C1=CC(=C(C(=C1)Cl)F)Cl)C(F)(F)F
Properties
SolubilitySparingly Soluble (4.1E-4 g/L) (25 °C), Calc.*
Density1.441±0.06 g/cm3 (20 °C 760 Torr), Calc.*
Index of Refraction1.476, Calc.*
Boiling Point268.6±40.0 °C (760 mmHg), Calc.*
Flash Point130.3±20.8 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319  Details
Safety StatementsP501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330  Details
SDSAvailable
up Discovery and Applications
1,3-Dichloro-2-fluoro-5-[1-(trifluoromethyl)ethenyl]-benzene is an aromatic fluorine-containing compound that has gained importance in various sectors due to its unique chemical structure and properties. The molecule is characterized by a benzene ring substituted with a dichloro group, a fluoro group, and a trifluoromethyl-ethenyl group. This combination of electronegative halogen atoms and a conjugated vinyl group makes the compound highly reactive, with potential for use in a variety of chemical applications.

The discovery of 1,3-dichloro-2-fluoro-5-[1-(trifluoromethyl)ethenyl]-benzene was part of the ongoing search for new chemical intermediates with specialized properties for material science, organic synthesis, and industrial chemistry. Its trifluoromethyl group, in particular, imparts enhanced hydrophobicity and increased stability in the presence of heat, moisture, and reactive chemicals. These features make it highly desirable for applications in the production of specialized polymers and other high-performance materials.

The compound is widely used in the synthesis of fluorinated organic compounds, which are valuable in the electronics, coatings, and polymer industries. The trifluoromethyl and fluoro substituents enhance the compound's resistance to chemical degradation and improve its performance in harsh environments. As a result, it is frequently used as a precursor in the production of fluoropolymer coatings, which are essential for a variety of industrial applications, including in semiconductor manufacturing, aerospace, and automotive industries. These coatings are prized for their durability, chemical resistance, and low friction properties.

Another important application of 1,3-dichloro-2-fluoro-5-[1-(trifluoromethyl)ethenyl]-benzene lies in agrochemical development. The presence of fluorine atoms in the structure improves the compound's bioavailability and stability, which are crucial for the synthesis of effective herbicides and pesticides. Its chemical reactivity allows it to be employed as an intermediate in the creation of more complex molecules, including those with specific biological activities. As the demand for more efficient and environmentally safe agrochemicals increases, compounds like 1,3-dichloro-2-fluoro-5-[1-(trifluoromethyl)ethenyl]-benzene will play a critical role in developing novel solutions to pest control.

Additionally, the compound is utilized in the pharmaceutical industry as a building block for the development of drug candidates. The unique properties of fluorinated organic molecules can enhance the efficacy and pharmacokinetics of pharmaceutical compounds. The trifluoromethyl group, in particular, is known to alter the metabolism of drugs, potentially increasing their half-life and bioavailability. As a result, 1,3-dichloro-2-fluoro-5-[1-(trifluoromethyl)ethenyl]-benzene has potential for use in the development of therapeutics with improved characteristics.

The synthesis of 1,3-dichloro-2-fluoro-5-[1-(trifluoromethyl)ethenyl]-benzene typically involves halogenation and vinylation reactions, where specific reagents are employed to introduce the halogen and trifluoromethyl groups into the benzene ring. These reactions are designed to maximize the yield of the desired product while maintaining high purity levels. Due to its reactivity, care must be taken when handling the compound to avoid unwanted side reactions and ensure its stability during storage and processing.

In summary, 1,3-dichloro-2-fluoro-5-[1-(trifluoromethyl)ethenyl]-benzene is a highly versatile chemical intermediate with significant applications in materials science, agrochemicals, and pharmaceuticals. Its unique structure, featuring multiple electronegative groups and a vinyl linkage, makes it an important building block in the development of advanced materials and specialty chemicals. As industries continue to seek more efficient and durable materials, the importance of such compounds will likely grow.
Market Analysis Reports
Related Products
2,4-Dichloro-7-...  2,4-Dichloro-5-...  2,4-Dichloro-8-...  2,4-Dichloro-6-...  4,7-Dichloro-6-...  3,3-Dichloro-6-...  2,3-Dichloro-6-...  (1'R,3'S)-5,7'-...  4,5-Dichloro-2-...  1,5-Dichloro-2-...  4,7-Dichloro-8-...  N-(4,6-Dichloro...  Dichloroformoxi...  N-[4,6-Dichloro...  2,4-Dichloro-al...  2,4-Dichloro-3-...  3,5-Dichloro-4-...  4 6-Dichloro-3-...  2-(2,6-Dichloro...  2,4-Dichloro-6-...