| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 2-(2-Methylpropyl)-Quinoline |
|---|---|
| Synonyms | 2-Isobutylquinoline; 2-Isobutyl Quinoline; 5-20-07-00484 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 |
| CAS Registry Number | 93-19-6 |
| EINECS | 202-227-2 |
| SMILES | C1=CC2=C(N=C1CC(C)C)C=CC=C2 |
| InChI | 1S/C13H15N/c1-10(2)9-12-8-7-11-5-3-4-6-13(11)14-12/h3-8,10H,9H2,1-2H3 |
| InChIKey | FAQVGPWFQGGIPP-UHFFFAOYSA-N |
| Density | 1.012g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.291°C at 760 mmHg (Cal.) |
| Flash point | 111.137°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(2-Methylpropyl)-Quinoline |