Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Thioquinox |
|---|---|
| Synonyms | Chebi:38822; 1,3-Dithiolo(4,5-B)Quinoxaline-2-Thione; 2,3-Quinoxalinedithiol Cyclic-Trithiocarbonate |
| Molecular Structure |  |
| Molecular Formula | C9H4N2S3 |
| Molecular Weight | 236.32 |
| CAS Registry Number | 93-75-4 |
| EINECS | 202-272-8 |
| SMILES | C1=CC=CC2=C1N=C3C(=N2)SC(S3)=S |
| InChI | 1S/C9H4N2S3/c12-9-13-7-8(14-9)11-6-4-2-1-3-5(6)10-7/h1-4H |
| InChIKey | ILERPRJWJPJZDN-UHFFFAOYSA-N |
| Density | 1.683g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.414°C at 760 mmHg (Cal.) |
| Flash point | 237.089°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thioquinox |