Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-[(Trimethylsilyl)methyl]-3-azatricyclo[3.2.1.02,4]octane |
|---|---|
| Synonyms | 3-((trimethylsilyl)methyl)-3-azatricyclo[3.2.1.02,4]octane |
| Molecular Structure | ![CAS#: 93098-41-0， 3-[(Trimethylsilyl)methyl]-3-azatricyclo[3.2.1.0<sup>2,4</sup>]octane](/moreStructures/93098-41-0.gif) |
| Molecular Formula | C11H21NSi |
| Molecular Weight | 195.38 |
| CAS Registry Number | 93098-41-0 |
| SMILES | C[Si](C)(C)CN1C2C1C3CCC2C3 |
| InChI | 1S/C11H21NSi/c1-13(2,3)7-12-10-8-4-5-9(6-8)11(10)12/h8-11H,4-7H2,1-3H3 |
| InChIKey | OSCXPLBCVYGQNP-UHFFFAOYSA-N |
| Density | 0.97g/cm3 (Cal.) |
|---|---|
| Boiling point | 211.493°C at 760 mmHg (Cal.) |
| Flash point | 81.708°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(Trimethylsilyl)methyl]-3-azatricyclo[3.2.1.02,4]octane |