|
CAS#: 93281-22-2 Product: Uranidil A No suppilers available for the product. |
| Name | Uranidil A |
|---|---|
| Synonyms | 2-Chloro-5-(1-Hydroxy-3-Oxo-Isoindolin-1-Yl)Benzenesulfonamide; 3,5-Diamino-6-Chloro-N-(Diaminomethylene)Pyrazine-2-Carboxamide; 2-Chloro-5-(1-Hydroxy-3-Oxo-1-Isoindolinyl)Benzenesulfonamide; 3,5-Diamino-6-Chloro-N-(Diaminomethylene)-2-Pyrazinecarboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H19Cl2N9O5S |
| Molecular Weight | 568.39 |
| CAS Registry Number | 93281-22-2 |
| SMILES | C2=C1C(O)(NC(=O)C1=CC=C2)C3=CC(=C(Cl)C=C3)[S](=O)(=O)N.C4(=C(N=C(N)C(=N4)Cl)N)C(=O)N=C(N)N |
| InChI | 1S/C14H11ClN2O4S.C6H8ClN7O/c15-11-6-5-8(7-12(11)22(16,20)21)14(19)10-4-2-1-3-9(10)13(18)17-14;7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11/h1-7,19H,(H,17,18)(H2,16,20,21);(H4,8,9,13)(H4,10,11,14,15) |
| InChIKey | BCNXVNJFMSWSQN-UHFFFAOYSA-N |
| Boiling point | 1002.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 560°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Uranidil A |