|
CAS#: 93341-45-8 Product: 2-Acetamido-3-(4-nitrophenyl)acrylic acid No suppilers available for the product. |
| Name | 2-Acetamido-3-(4-nitrophenyl)acrylic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 |
| CAS Registry Number | 93341-45-8 |
| SMILES | [O-][N+](=O)c1ccc(C=C(NC(=O)C)C(=O)O)cc1 |
| InChI | 1S/C11H10N2O5/c1-7(14)12-10(11(15)16)6-8-2-4-9(5-3-8)13(17)18/h2-6H,1H3,(H,12,14)(H,15,16) |
| InChIKey | WXJKFHSOMYAKSR-UHFFFAOYSA-N |
| Density | 1.425g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.744°C at 760 mmHg (Cal.) |
| Flash point | 260.874°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Acetamido-3-(4-nitrophenyl)acrylic acid |