|
CAS#: 934-90-7 Product: alpha-Methyl-1-piperidineethanol No suppilers available for the product. |
| Name | alpha-Methyl-1-piperidineethanol |
|---|---|
| Synonyms | (2S)-1-(1-Piperidin-1-Iumyl)Propan-2-Ol; Zinc00154439 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H18NO |
| Molecular Weight | 144.24 |
| CAS Registry Number | 934-90-7 |
| EINECS | 213-295-8 |
| SMILES | [C@@H](O)(C[NH+]1CCCCC1)C |
| InChI | 1S/C8H17NO/c1-8(10)7-9-5-3-2-4-6-9/h8,10H,2-7H2,1H3/p+1/t8-/m0/s1 |
| InChIKey | UCASFSAKVJTSET-QMMMGPOBSA-O |
| Boiling point | 221.792°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 90.938°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for alpha-Methyl-1-piperidineethanol |