Online Database of Chemicals from Around the World
|
CAS#: 93427-29-3 Product: 1-(2-Bromoethyl)-3,5-bis(trifluoromethyl)benzene No suppilers available for the product. |
| Name | 1-(2-Bromoethyl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| Synonyms | 1-(2-Bromethyl)-3,5-bis(trifluormethyl)benzol; 1-(2-Bromoethyl)-3,5-bis(trifluoromethyl)benzene; 1-(2-Bromoéthyl)-3,5-bis(trifluorométhyl)benzène |
| Molecular Structure |  |
| Molecular Formula | C10H7BrF6 |
| Molecular Weight | 321.06 |
| CAS Registry Number | 93427-29-3 |
| SMILES | c1c(cc(cc1C(F)(F)F)C(F)(F)F)CCBr |
| InChI | 1S/C10H7BrF6/c11-2-1-6-3-7(9(12,13)14)5-8(4-6)10(15,16)17/h3-5H,1-2H2 |
| InChIKey | QQEAGUOAOUVLNK-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 196.0±35.0°C at 760 mmHg (Cal.) |
| Flash point | 72.4±25.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Bromoethyl)-3,5-bis(trifluoromethyl)benzene |