|
CAS#: 934342-48-0 Product: 2-(3-Methoxy-1-propen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane No suppilers available for the product. |
| Name | 2-(3-Methoxy-1-propen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| Synonyms | 1,3,2-Dio |
| Molecular Structure | ![]() |
| Molecular Formula | C10H19BO3 |
| Molecular Weight | 198.07 |
| CAS Registry Number | 934342-48-0 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=CCOC |
| InChI | 1S/C10H19BO3/c1-9(2)10(3,4)14-11(13-9)7-6-8-12-5/h6-7H,8H2,1-5H3 |
| InChIKey | FBAOFKFCKHJXRU-UHFFFAOYSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 210.4±42.0°C at 760 mmHg (Cal.) |
| Flash point | 81.1±27.9°C (Cal.) |
| Refractive index | 1.435 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Methoxy-1-propen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |