Online Database of Chemicals from Around the World
|
CAS#: 93445-70-6 Product: 5-Amino-4-hydroxy-2-quinolinecarboxylic acid No suppilers available for the product. |
| Name | 5-Amino-4-hydroxy-2-quinolinecarboxylic acid |
|---|---|
| Synonyms | 5-amino-4-oxo-1,4-dihydroquinoline-2-carboxylic acid; 5-Amino-4-oxo-1,4-dihydro-quinoline-2-carboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18 |
| CAS Registry Number | 93445-70-6 |
| SMILES | C1=CC(=C2C(=C1)N=C(C=C2O)C(=O)O)N |
| InChI | 1S/C10H8N2O3/c11-5-2-1-3-6-9(5)8(13)4-7(12-6)10(14)15/h1-4H,11H2,(H,12,13)(H,14,15) |
| InChIKey | YDNCBFOCOUQJFG-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.2±50.0°C at 760 mmHg (Cal.) |
| Flash point | 264.8±30.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-4-hydroxy-2-quinolinecarboxylic acid |