|
CAS#: 934570-43-1 Product: 1-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indoline No suppilers available for the product. |
| Name | 1-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indoline |
|---|---|
| Synonyms | 4,4,5,5-t |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22BNO2 |
| Molecular Weight | 259.15 |
| CAS Registry Number | 934570-43-1 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)c2ccc3c(c2)CCN3C |
| InChI | 1S/C15H22BNO2/c1-14(2)15(3,4)19-16(18-14)12-6-7-13-11(10-12)8-9-17(13)5/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | CZYIGZLFKRAXMV-UHFFFAOYSA-N |
| Density | 1.075g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.202°C at 760 mmHg (Cal.) |
| Flash point | 187.973°C (Cal.) |
| Refractive index | 1.536 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indoline |