Online Database of Chemicals from Around the World
|
CAS#: 934570-50-0 Product: 4-(3-Bromo-2-thienyl)benzoyl chloride No suppilers available for the product. |
| Name | 4-(3-Bromo-2-thienyl)benzoyl chloride |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C11H6BrClOS |
| Molecular Weight | 301.59 |
| CAS Registry Number | 934570-50-0 |
| SMILES | c1cc(ccc1c2c(ccs2)Br)C(=O)Cl |
| InChI | 1S/C11H6BrClOS/c12-9-5-6-15-10(9)7-1-3-8(4-2-7)11(13)14/h1-6H |
| InChIKey | FNHRRPMNJHHELO-UHFFFAOYSA-N |
| Density | 1.615g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.634°C at 760 mmHg (Cal.) |
| Flash point | 174.324°C (Cal.) |
| Refractive index | 1.638 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Bromo-2-thienyl)benzoyl chloride |