|
CAS#: 934570-60-2 Product: 2-Methyl-2-propanyl 2-chloro-1,3-thiazole-5-carboxylate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl 2-chloro-1,3-thiazole-5-carboxylate |
|---|---|
| Synonyms | tert-butyl 2-chloro-1,3-thiazole-5-carboxylate; tert-butyl-2-chloro-1,3-thiazole-5-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10ClNO2S |
| Molecular Weight | 219.69 |
| CAS Registry Number | 934570-60-2 |
| SMILES | CC(C)(C)OC(=O)c1cnc(s1)Cl |
| InChI | 1S/C8H10ClNO2S/c1-8(2,3)12-6(11)5-4-10-7(9)13-5/h4H,1-3H3 |
| InChIKey | SQZXVWDARSIXTM-UHFFFAOYSA-N |
| Density | 1.281g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.508°C at 760 mmHg (Cal.) |
| Flash point | 133.728°C (Cal.) |
| Refractive index | 1.533 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl 2-chloro-1,3-thiazole-5-carboxylate |