Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-Methyl-2-propanyl benzyl(4-piperidinyl)carbamate |
|---|---|
| Synonyms | tert-butyl benzyl(piperidin-4-yl)carbamate; TERT-BUTYL N-BENZYL-N-(PIPERIDIN-4-YL)CARBAMATE |
| Molecular Structure |  |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.40 |
| CAS Registry Number | 934695-78-0 |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)C2CCNCC2 |
| InChI | 1S/C17H26N2O2/c1-17(2,3)21-16(20)19(15-9-11-18-12-10-15)13-14-7-5-4-6-8-14/h4-8,15,18H,9-13H2,1-3H3 |
| InChIKey | VPTUTEIQMQFSBU-UHFFFAOYSA-N |
| Density | 1.076g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.413°C at 760 mmHg (Cal.) |
| Flash point | 198.987°C (Cal.) |
| Refractive index | 1.542 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl benzyl(4-piperidinyl)carbamate |