Online Database of Chemicals from Around the World
3-[5-[(2,3-Difluoro-6-methoxyphenyl)methoxy]-2-fluoro-4-methoxyphenyl]-1,2,3,4-tetrahydro-2,4-dioxothieno[3,4-d]pyrimidine-5-carboxylic acid
[CAS# 935283-04-8]
Identification| Name | 3-[5-[(2,3-Difluoro-6-methoxyphenyl)methoxy]-2-fluoro-4-methoxyphenyl]-1,2,3,4-tetrahydro-2,4-dioxothieno[3,4-d]pyrimidine-5-carboxylic acid |
|---|
| Synonyms | KLH 2109; Linzagolix; OBE 2109 |
|
| Molecular Structure | ![CAS # 935283-04-8, 3-[5-[(2,3-Difluoro-6-methoxyphenyl)methoxy]-2-fluoro-4-methoxyphenyl]-1,2,3,4-tetrahydro-2,4-dioxothieno[3,4-d]pyrimidine-5-carboxylic acid](/structures/935283-04-8.gif) |
| Molecular Formula | C22H15F3N2O7S |
| Molecular Weight | 508.42 |
| CAS Registry Number | 935283-04-8 |
| SMILES | O=C(O)C=1SC=C2NC(=O)N(C(=O)C12)C=3C=C(OCC4=C(F)C(F)=CC=C4OC)C(OC)=CC3F |
|
Properties
| Solubility | Practically insoluble (0.014 g/L g/L) (25 °C), Calc.* |
| pKa | 3.26±0.20 (Most acidic 25 °C), Calc.* |
| Density | 1.550±0.06 g/cm3 (20 °C 760 Torr), Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software V11.02 (© 1994-2022 ACD/Labs) |
|
Related Products