Online Database of Chemicals from Around the World
|
CAS#: 93535-04-7 Product: 4-Amino-3'-chlorostilbene No suppilers available for the product. |
| Name | 4-Amino-3'-chlorostilbene |
|---|---|
| Synonyms | 4-[(E)-2-(3-Chlorophenyl)Vinyl]Aniline; [4-[(E)-2-(3-Chlorophenyl)Vinyl]Phenyl]Amine; 4-(2-(3-Chlorophenyl)Ethenyl)Benzenamine |
| Molecular Structure |  |
| Molecular Formula | C14H12ClN |
| Molecular Weight | 229.71 |
| CAS Registry Number | 93535-04-7 |
| SMILES | C1=CC(=CC=C1N)\C=C\C2=CC(=CC=C2)Cl |
| InChI | 1S/C14H12ClN/c15-13-3-1-2-12(10-13)5-4-11-6-8-14(16)9-7-11/h1-10H,16H2/b5-4+ |
| InChIKey | IPJQKOADVGRNMS-SNAWJCMRSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.937°C at 760 mmHg (Cal.) |
| Flash point | 194.466°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-3'-chlorostilbene |