|
CAS#: 935460-27-8 Product: 1-[3-(Tetrahydro-3-furanyl)phenyl]cyclopropanamine No suppilers available for the product. |
| Name | 1-[3-(Tetrahydro-3-furanyl)phenyl]cyclopropanamine |
|---|---|
| Synonyms | Cyclopropanamine, 1-[3-(tetrahydro-3-furanyl)phenyl]-; Cyclopropanamine,1-[3-(tetrahydro-3-furanyl)phenyl]- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 |
| CAS Registry Number | 935460-27-8 |
| SMILES | c1cc(cc(c1)C2(CC2)N)C3CCOC3 |
| InChI | 1S/C13H17NO/c14-13(5-6-13)12-3-1-2-10(8-12)11-4-7-15-9-11/h1-3,8,11H,4-7,9,14H2 |
| InChIKey | ACZFMDFLUWXYPF-UHFFFAOYSA-N |
| Density | 1.142g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.526°C at 760 mmHg (Cal.) |
| Flash point | 147.728°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(Tetrahydro-3-furanyl)phenyl]cyclopropanamine |