Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,2,4,5,8-Naphthalenepentol |
|---|---|
| Synonyms | 1,2,4,5,8-Naphthalenepentol; naphthalene-1,2,4,5,8-pentaol |
| Molecular Structure |  |
| Molecular Formula | C10H8O5 |
| Molecular Weight | 208.17 |
| CAS Registry Number | 93674-93-2 |
| SMILES | c1cc(c2c(c1O)c(cc(c2O)O)O)O |
| InChI | 1S/C10H8O5/c11-4-1-2-5(12)9-8(4)6(13)3-7(14)10(9)15/h1-3,11-15H |
| InChIKey | IPRQZGOTLNVIAP-UHFFFAOYSA-N |
| Density | 1.799g/cm3 (Cal.) |
|---|---|
| Boiling point | 667.265°C at 760 mmHg (Cal.) |
| Flash point | 342.543°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,5,8-Naphthalenepentol |