Online Database of Chemicals from Around the World
| Naturewill Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 | www.naturewillbio.com | |||
 | +86 (28) 8263-2533 | |||
 | info@naturewillbio.com | |||
 | QQ Chat | |||
| Chemical manufacturer since 2005 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | Boldine EP Impurity B |
|---|---|
| Synonyms | (6aS)-1,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol N-oxide |
| Molecular Structure |  |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.37 |
| CAS Registry Number | 937018-76-3 |
| SMILES | COC(C1=C(C(CC2)=C3)[C@]([N@@+]2([O-])C)([H])CC(C=C4O)=C1C=C4OC)=C3O |
| Market Analysis Reports |
| List of Reports Available for Boldine EP Impurity B |