|
CAS#: 937796-15-1 Product: [2-(4-Morpholinylsulfonyl)phenyl]methanol No suppilers available for the product. |
| Name | [2-(4-Morpholinylsulfonyl)phenyl]methanol |
|---|---|
| Synonyms | 4-{[2-(hydroxymethyl)phenyl]sulfonyl}morpholine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 |
| CAS Registry Number | 937796-15-1 |
| SMILES | c1ccc(c(c1)CO)S(=O)(=O)N2CCOCC2 |
| InChI | 1S/C11H15NO4S/c13-9-10-3-1-2-4-11(10)17(14,15)12-5-7-16-8-6-12/h1-4,13H,5-9H2 |
| InChIKey | BOQHDNNWBAICEW-UHFFFAOYSA-N |
| Density | 1.357g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.499°C at 760 mmHg (Cal.) |
| Flash point | 234.116°C (Cal.) |
| Refractive index | 1.588 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2-(4-Morpholinylsulfonyl)phenyl]methanol |