Online Database of Chemicals from Around the World
|
CAS#: 93780-04-2 Product: (2R)-2-Benzyl-4-pentenoic acid No suppilers available for the product. |
| Name | (2R)-2-Benzyl-4-pentenoic acid |
|---|---|
| Synonyms | (R)-2-BENZYL-5-PENTENOICACID |
| Molecular Structure |  |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 93780-04-2 |
| SMILES | C=CC[C@H](Cc1ccccc1)C(=O)O |
| InChI | 1S/C12H14O2/c1-2-6-11(12(13)14)9-10-7-4-3-5-8-10/h2-5,7-8,11H,1,6,9H2,(H,13,14)/t11-/m1/s1 |
| InChIKey | VDJGCNARLOCVIY-LLVKDONJSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.076°C at 760 mmHg (Cal.) |
| Flash point | 213.147°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-2-Benzyl-4-pentenoic acid |