|
CAS#: 93803-21-5 Product: L-Ornithine sulfate (1:1) No suppilers available for the product. |
| Name | L-Ornithine sulfate (1:1) |
|---|---|
| Synonyms | L-ornithine sulphate; L-ORNITHINESULFATE |
| Molecular Structure | ![]() |
| Molecular Formula | C5H14N2O6S |
| Molecular Weight | 230.24 |
| CAS Registry Number | 93803-21-5 |
| EINECS | 298-290-9 |
| SMILES | OC(=O)[C@@H](N)CCCN.OS(O)(=O)=O |
| InChI | 1S/C5H12N2O2.H2O4S/c6-3-1-2-4(7)5(8)9;1-5(2,3)4/h4H,1-3,6-7H2,(H,8,9);(H2,1,2,3,4)/t4-;/m0./s1 |
| InChIKey | WFZXUCAVKMKCSA-WCCKRBBISA-N |
| Boiling point | 528.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 273.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Ornithine sulfate (1:1) |