Online Database of Chemicals from Around the World
|
CAS#: 93805-56-2 Product: N,N-Dimethyl(Nitrobenzyl)Amine No suppilers available for the product. |
| Name | N,N-Dimethyl(Nitrobenzyl)Amine |
|---|---|
| Synonyms | N,N-Dimethyl-1-Nitro-1-Phenyl-Methanamine; Dimethyl-(Nitro-Phenyl-Methyl)Amine |
| Molecular Structure |  |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 |
| CAS Registry Number | 93805-56-2 |
| EINECS | 298-540-7 |
| SMILES | C1=C(C([N+]([O-])=O)N(C)C)C=CC=C1 |
| InChI | 1S/C9H12N2O2/c1-10(2)9(11(12)13)8-6-4-3-5-7-8/h3-7,9H,1-2H3 |
| InChIKey | NJACXLNZLIIPJQ-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.382°C at 760 mmHg (Cal.) |
| Flash point | 90.713°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl(Nitrobenzyl)Amine |