Online Database of Chemicals from Around the World
|
CAS#: 93839-97-5 Product: Iron(2+) 3-nitro-1,5-naphthalenedisulfonate No suppilers available for the product. |
| Name | Iron(2+) 3-nitro-1,5-naphthalenedisulfonate |
|---|---|
| Synonyms | iron 3-nitronaphthalene-1,5-disulphonate |
| Molecular Structure |  |
| Molecular Formula | C10H5FeNO8S2 |
| Molecular Weight | 387.12 |
| CAS Registry Number | 93839-97-5 |
| EINECS | 298-871-7 |
| SMILES | [Fe+2].[O-]S(=O)(=O)c2cccc1c2cc(cc1S([O-])(=O)=O)[N+]([O-])=O |
| InChI | 1S/C10H7NO8S2.Fe/c12-11(13)6-4-8-7(10(5-6)21(17,18)19)2-1-3-9(8)20(14,15)16;/h1-5H,(H,14,15,16)(H,17,18,19);/q;+2/p-2 |
| InChIKey | HKMHVNJPHJFIJA-UHFFFAOYSA-L |
| Market Analysis Reports |
| List of Reports Available for Iron(2+) 3-nitro-1,5-naphthalenedisulfonate |