Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)-1-Penten-3-Ol |
|---|---|
| Synonyms | 1-Penten-3-Ol, 1-(2,2,6-Trimethylcyclohexyl)-, Didehydro Deriv.; 1-Penten-3-Ol, 1-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)-; Methyl Beta-Ionol |
| Molecular Structure |  |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 |
| CAS Registry Number | 93840-90-5 |
| EINECS | 298-957-4 |
| SMILES | C(C(O)/C=C/C1=C(CCCC1(C)C)C)C |
| InChI | 1S/C14H24O/c1-5-12(15)8-9-13-11(2)7-6-10-14(13,3)4/h8-9,12,15H,5-7,10H2,1-4H3/b9-8+ |
| InChIKey | DZSNHSUUMHDJRJ-CMDGGOBGSA-N |
| Density | 0.943g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.533°C at 760 mmHg (Cal.) |
| Flash point | 109.951°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)-1-Penten-3-Ol |