Online Database of Chemicals from Around the World
|
CAS#: 93858-45-8 Product: (4-Methylphenyl)Methyl Methacrylate No suppilers available for the product. |
| Name | (4-Methylphenyl)Methyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid (4-Methylphenyl)Methyl Ester; 2-Methylacrylic Acid (4-Methylbenzyl) Ester; (4-Methylphenyl)Methyl Methacrylate |
| Molecular Structure |  |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 93858-45-8 |
| EINECS | 299-276-5 |
| SMILES | C1=C(COC(=O)C(=C)C)C=CC(=C1)C |
| InChI | 1S/C12H14O2/c1-9(2)12(13)14-8-11-6-4-10(3)5-7-11/h4-7H,1,8H2,2-3H3 |
| InChIKey | ZALFZMYXGFDRIW-UHFFFAOYSA-N |
| Density | 1.02g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.753°C at 760 mmHg (Cal.) |
| Flash point | 135.929°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Methylphenyl)Methyl Methacrylate |